ChemNet > CAS > 1271-86-9 N,N-dimethylaminomethylferrocene
1271-86-9 N,N-dimethylaminomethylferrocene
| produktnavn |
N,N-dimethylaminomethylferrocene |
| Engelsk navn |
N,N-dimethylaminomethylferrocene; N,N-dimethylaminomethyl ferrocene; FERROCENYLMETHYLDIMETHYLAMINE; DimethylaminomethylFERROCENCE; CYCLOPENTADIENYL(Dimethylaminomethyl)CYCLOPENTADLENYL IRON; (DIMETHYLAMINO)METHYL]-ferrocen; (Dimethylaminomethyl)ferrocene; iron(2+) cyclopenta-2,4-dienide 2-[(dimethylamino)methyl]cyclopenta-2,4-dienide (1:1:1); cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanaminium |
| Molekylær Formel |
C8H14N |
| Molekylvekt |
124.2029 |
| InChI |
InChI=1/C8H13N/c1-9(2)7-8-5-3-4-6-8/h3-6,8H,7H2,1-2H3/p+1 |
| CAS-nummer |
1271-86-9 |
| EINECS |
215-044-8 |
| Molecular Structure |
|
| Kokepunkt |
152.9°C at 760 mmHg |
| Flammepunktet |
38.6°C |
| Damptrykk |
3.42mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
