ChemNet > CAS > 127957-83-9 etyl-2-amino-4-propylpyrimidin-5-karboksylat
127957-83-9 etyl-2-amino-4-propylpyrimidin-5-karboksylat
| produktnavn |
etyl-2-amino-4-propylpyrimidin-5-karboksylat |
| Engelsk navn |
ethyl 2-amino-4-propylpyrimidine-5-carboxylate; |
| Molekylær Formel |
C10H15N3O2 |
| Molekylvekt |
209.245 |
| InChI |
InChI=1/C10H15N3O2/c1-3-5-8-7(9(14)15-4-2)6-12-10(11)13-8/h6H,3-5H2,1-2H3,(H2,11,12,13) |
| CAS-nummer |
127957-83-9 |
| Molecular Structure |
|
| Tetthet |
1.15g/cm3 |
| Smeltepunkt |
127℃ |
| Kokepunkt |
396.9°C at 760 mmHg |
| Brytningsindeks |
1.542 |
| Flammepunktet |
193.8°C |
| Damptrykk |
1.65E-06mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|