ChemNet > CAS > 13074-65-2 Hexylcyclopentanone; 98%
13074-65-2 Hexylcyclopentanone; 98%
produktnavn |
Hexylcyclopentanone; 98% |
Engelsk navn |
Hexylcyclopentanone; 98%; 2-n-Hexylcyclopentanone; 2-hexylcyclopentanone |
Molekylær Formel |
C11H20O |
Molekylvekt |
168.2759 |
InChI |
InChI=1/C11H20O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h10H,2-9H2,1H3 |
CAS-nummer |
13074-65-2 |
EINECS |
235-970-6 |
Molecular Structure |
|
Tetthet |
0.891g/cm3 |
Kokepunkt |
234.9°C at 760 mmHg |
Brytningsindeks |
1.453 |
Flammepunktet |
88.6°C |
Damptrykk |
0.0517mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|