13194-68-8 4-iodo-2-methylaniline
produktnavn |
4-iodo-2-methylaniline |
Engelsk navn |
4-iodo-2-methylaniline; 2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
Molekylær Formel |
C7H8IN |
Molekylvekt |
233.0496 |
InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
CAS-nummer |
13194-68-8 |
EINECS |
236-154-2 |
Molecular Structure |
|
Tetthet |
1.791g/cm3 |
Smeltepunkt |
86-89℃ |
Kokepunkt |
278.4°C at 760 mmHg |
Brytningsindeks |
1.663 |
Flammepunktet |
122.1°C |
Damptrykk |
0.00428mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|