ChemNet > CAS > 13194-73-5 3,5-Dibromo-4-methylaniline
13194-73-5 3,5-Dibromo-4-methylaniline
| produktnavn |
3,5-Dibromo-4-methylaniline |
| Engelsk navn |
3,5-Dibromo-4-methylaniline; 3,5-Dibromo-p-toluidine |
| Molekylær Formel |
C7H7Br2N |
| Molekylvekt |
264.9452 |
| InChI |
InChI=1/C7H7Br2N/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,10H2,1H3 |
| CAS-nummer |
13194-73-5 |
| Molecular Structure |
|
| Tetthet |
1.887g/cm3 |
| Kokepunkt |
308.8°C at 760 mmHg |
| Brytningsindeks |
1.641 |
| Flammepunktet |
140.6°C |
| Damptrykk |
0.000664mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
