ChemNet > CAS > 132898-95-4 2,2'-bitiofen-5-boronsyre
132898-95-4 2,2'-bitiofen-5-boronsyre
| produktnavn |
2,2'-bitiofen-5-boronsyre |
| Synonymer |
2,2'-bithiophen-5-ylboronsyre |
| Engelsk navn |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
| Molekylær Formel |
C8H7BO2S2 |
| Molekylvekt |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| CAS-nummer |
132898-95-4 |
| Molecular Structure |
|
| Tetthet |
1.42g/cm3 |
| Smeltepunkt |
127℃ |
| Kokepunkt |
416.1°C at 760 mmHg |
| Brytningsindeks |
1.658 |
| Flammepunktet |
205.5°C |
| Damptrykk |
1.14E-07mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
