ChemNet > CAS > 13368-86-0 1,2,5-tiadiazol-3-karboksylsyre
13368-86-0 1,2,5-tiadiazol-3-karboksylsyre
| produktnavn |
1,2,5-tiadiazol-3-karboksylsyre |
| Engelsk navn |
1,2,5-Thiadiazole-3-carboxylic acid; |
| Molekylær Formel |
C3H2N2O2S |
| Molekylvekt |
130.1252 |
| InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-4-8-5-2/h1H,(H,6,7) |
| CAS-nummer |
13368-86-0 |
| Molecular Structure |
|
| Tetthet |
1.67g/cm3 |
| Smeltepunkt |
89℃ |
| Kokepunkt |
292.8°C at 760 mmHg |
| Brytningsindeks |
1.631 |
| Flammepunktet |
130.9°C |
| Damptrykk |
0.000817mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
