ChemNet > CAS > 13431-34-0 4-Ethyl-3-thiosemicarbazide
13431-34-0 4-Ethyl-3-thiosemicarbazide
| produktnavn |
4-Ethyl-3-thiosemicarbazide |
| Engelsk navn |
4-Ethyl-3-thiosemicarbazide; |
| Molekylær Formel |
C3H9N3S |
| Molekylvekt |
119.1887 |
| InChI |
InChI=1/C3H9N3S/c1-2-5-3(7)6-4/h2,4H2,1H3,(H2,5,6,7) |
| CAS-nummer |
13431-34-0 |
| EINECS |
236-553-1 |
| Molecular Structure |
|
| Tetthet |
1.142g/cm3 |
| Smeltepunkt |
80-85℃ |
| Kokepunkt |
187.4°C at 760 mmHg |
| Brytningsindeks |
1.564 |
| Flammepunktet |
67.2°C |
| Damptrykk |
0.63mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
