ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
produktnavn |
1-(2-Chlorophenyl)ethanol |
Engelsk navn |
1-(2-Chlorophenyl)ethanol; 2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
Molekylær Formel |
C8H9ClO |
Molekylvekt |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
CAS-nummer |
13524-04-4 |
EINECS |
236-868-4 |
Molecular Structure |
|
Tetthet |
1.182g/cm3 |
Kokepunkt |
231.4°C at 760 mmHg |
Brytningsindeks |
1.55 |
Flammepunktet |
93.8°C |
Damptrykk |
0.0348mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|