ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| produktnavn |
2-acetyl-3-methylthiophene |
| Engelsk navn |
2-acetyl-3-methylthiophene; 1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| Molekylær Formel |
C7H8OS |
| Molekylvekt |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| CAS-nummer |
13679-72-6 |
| EINECS |
237-179-1 |
| Molecular Structure |
|
| Tetthet |
1.106g/cm3 |
| Kokepunkt |
214.9°C at 760 mmHg |
| Brytningsindeks |
1.535 |
| Flammepunktet |
92.3°C |
| Damptrykk |
0.152mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
