ChemNet > CAS > 13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
produktnavn |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol |
Engelsk navn |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol;alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol; 2-chloro-1-(2,4-dichlorophenyl)ethanol; (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol; (1R)-2-chloro-1-(2,4-dichlorophenyl)ethanol |
Molekylær Formel |
C8H7Cl3O |
Molekylvekt |
225.4996 |
InChI |
InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/m0/s1 |
CAS-nummer |
13692-14-3 |
EINECS |
237-206-7 |
Molecular Structure |
|
Tetthet |
1.447g/cm3 |
Smeltepunkt |
48-52℃ |
Kokepunkt |
323.3°C at 760 mmHg |
Brytningsindeks |
1.581 |
Flammepunktet |
149.3°C |
Damptrykk |
0.000109mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|