140-38-5 4-Chlorophenylurea
produktnavn |
4-Chlorophenylurea |
Engelsk navn |
4-Chlorophenylurea;Urea, 1-(p-chlorophenyl)-; (p-Chlorophenyl)urea; 1-(p-Chlorophenyl)urea; 4-12-00-01191 (Beilstein Handbook Reference); AI3-20197; BRN 0908492; NSC 12971; p-CPU; (4-Chlorophenyl)urea; Urea, (4-chlorophenyl)-; Urea, (p-chlorophenyl)- (8CI); 1-(4-chlorophenyl)urea |
Molekylær Formel |
C7H7ClN2O |
Molekylvekt |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-nummer |
140-38-5 |
EINECS |
205-412-6 |
Molecular Structure |
|
Tetthet |
1.402g/cm3 |
Kokepunkt |
271.7°C at 760 mmHg |
Brytningsindeks |
1.649 |
Flammepunktet |
118.1°C |
Damptrykk |
0.00634mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|