ChemNet > CAS > 1436-43-7 2-quinolinecarbonitrile
1436-43-7 2-quinolinecarbonitrile
| produktnavn |
2-quinolinecarbonitrile |
| Engelsk navn |
2-quinolinecarbonitrile; Quinoline-2-carbonitrile; 2-Cyanoquinoline |
| Molekylær Formel |
C10H6N2 |
| Molekylvekt |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
| CAS-nummer |
1436-43-7 |
| EINECS |
215-865-1 |
| Molecular Structure |
|
| Tetthet |
1.21g/cm3 |
| Smeltepunkt |
93-95℃ |
| Kokepunkt |
323.7°C at 760 mmHg |
| Brytningsindeks |
1.654 |
| Flammepunktet |
115.5°C |
| Damptrykk |
0.000258mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
