ChemNet > CAS > 144284-25-3 2,4,5-trifluorobenzyl alcohol
144284-25-3 2,4,5-trifluorobenzyl alcohol
| produktnavn |
2,4,5-trifluorobenzyl alcohol |
| Engelsk navn |
2,4,5-trifluorobenzyl alcohol; (2,4,5-trifluorophenyl)methanol |
| Molekylær Formel |
C7H5F3O |
| Molekylvekt |
162.11 |
| InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
| CAS-nummer |
144284-25-3 |
| Molecular Structure |
|
| Tetthet |
1.858g/cm3 |
| Kokepunkt |
213.308°C at 760 mmHg |
| Brytningsindeks |
1.55 |
| Flammepunktet |
82.806°C |
| Damptrykk |
0.113mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
