1457-47-2 N-Allylrhodanine
produktnavn |
N-Allylrhodanine |
Engelsk navn |
N-Allylrhodanine; |
Molekylær Formel |
C6H7NOS2 |
Molekylvekt |
173.2559 |
InChI |
InChI=1/C6H7NOS2/c1-2-3-7-5(8)4-10-6(7)9/h2H,1,3-4H2 |
CAS-nummer |
1457-47-2 |
EINECS |
215-941-4 |
Molecular Structure |
|
Tetthet |
1.35g/cm3 |
Smeltepunkt |
43-46℃ |
Kokepunkt |
248.8°C at 760 mmHg |
Brytningsindeks |
1.651 |
Flammepunktet |
104.3°C |
Damptrykk |
0.0238mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|