ChemNet > CAS > 14572-89-5 1-(4-Aminophenyl)ethanol
14572-89-5 1-(4-Aminophenyl)ethanol
| produktnavn |
1-(4-Aminophenyl)ethanol |
| Engelsk navn |
1-(4-Aminophenyl)ethanol; 4-Amino-alpha-methylbenzyl alcohol~4-Aminophenyl methyl carbinol~4-(alpha-Hydroxyethyl)aniline; (1S)-1-(4-aminophenyl)ethanol; (1R)-1-(4-aminophenyl)ethanol |
| Molekylær Formel |
C8H11NO |
| Molekylvekt |
137.179 |
| InChI |
InChI=1/C8H11NO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,9H2,1H3/t6-/m1/s1 |
| CAS-nummer |
14572-89-5 |
| EINECS |
238-613-2 |
| Molecular Structure |
|
| Tetthet |
1.117g/cm3 |
| Kokepunkt |
288.5°C at 760 mmHg |
| Brytningsindeks |
1.592 |
| Flammepunktet |
128.3°C |
| Damptrykk |
0.00108mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
