ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
produktnavn |
1,15-Pentadecanedioic acid |
Engelsk navn |
1,15-Pentadecanedioic acid; Pentadecanedioic acid |
Molekylær Formel |
C15H28O4 |
Molekylvekt |
272.3804 |
InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
CAS-nummer |
1460-18-0 |
Molecular Structure |
|
Tetthet |
1.026g/cm3 |
Smeltepunkt |
113-114℃ |
Kokepunkt |
445.8°C at 760 mmHg |
Brytningsindeks |
1.474 |
Flammepunktet |
237.5°C |
Damptrykk |
3.44E-09mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|