ChemNet > CAS > 1470-57-1 2-Hydroxy-5-methylbenzophenone
1470-57-1 2-Hydroxy-5-methylbenzophenone
| produktnavn |
2-Hydroxy-5-methylbenzophenone |
| Engelsk navn |
2-Hydroxy-5-methylbenzophenone;(2-hydroxy-5-methylphenyl)(phenyl)methanone |
| Molekylær Formel |
C14H12O2 |
| Molekylvekt |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-10-7-8-13(15)12(9-10)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3 |
| CAS-nummer |
1470-57-1 |
| EINECS |
216-002-1 |
| Molecular Structure |
|
| Tetthet |
1.164g/cm3 |
| Smeltepunkt |
83-85℃ |
| Kokepunkt |
340.2°C at 760 mmHg |
| Brytningsindeks |
1.604 |
| Flammepunktet |
144.8°C |
| Damptrykk |
4.44E-05mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
