14804-31-0 Bromomethoxytoluene
produktnavn |
Bromomethoxytoluene |
Engelsk navn |
Bromomethoxytoluene; 5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
Molekylær Formel |
C8H9BrO |
Molekylvekt |
201.0605 |
InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
CAS-nummer |
14804-31-0 |
Molecular Structure |
|
Tetthet |
1.378g/cm3 |
Smeltepunkt |
66-69℃ |
Kokepunkt |
226.1°C at 760 mmHg |
Brytningsindeks |
1.535 |
Flammepunktet |
102.3°C |
Damptrykk |
0.125mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|