1492-30-4 4-nitrophenyl palmitate
produktnavn |
4-nitrophenyl palmitate |
Engelsk navn |
4-nitrophenyl palmitate; 4-Nitrophenyl hexadecanoate; Palmitic acid 4-nitrophenyl ester; 4-Nitrophenol palmitate |
Molekylær Formel |
C22H35NO4 |
Molekylvekt |
377.5176 |
InChI |
InChI=1/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(24)27-21-18-16-20(17-19-21)23(25)26/h16-19H,2-15H2,1H3 |
CAS-nummer |
1492-30-4 |
EINECS |
216-084-9 |
Molecular Structure |
|
Tetthet |
1.02g/cm3 |
Smeltepunkt |
60℃ |
Kokepunkt |
483.6°C at 760 mmHg |
Brytningsindeks |
1.5 |
Flammepunktet |
160.7°C |
Damptrykk |
1.66E-09mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|