ChemNet > CAS > 1501-06-0 Diethyl 2-acetylglutarate
1501-06-0 Diethyl 2-acetylglutarate
produktnavn |
Diethyl 2-acetylglutarate |
Engelsk navn |
Diethyl 2-acetylglutarate; 2-Acetylglutaric acid diethyl ester; diethyl 2-acetylpentanedioate; diethyl (2R)-2-acetylpentanedioate; diethyl (2S)-2-acetylpentanedioate |
Molekylær Formel |
C11H18O5 |
Molekylvekt |
230.2576 |
InChI |
InChI=1/C11H18O5/c1-4-15-10(13)7-6-9(8(3)12)11(14)16-5-2/h9H,4-7H2,1-3H3/t9-/m0/s1 |
CAS-nummer |
1501-06-0 |
EINECS |
216-114-0 |
Molecular Structure |
|
Tetthet |
1.073g/cm3 |
Kokepunkt |
291.2°C at 760 mmHg |
Brytningsindeks |
1.439 |
Flammepunktet |
127.5°C |
Damptrykk |
0.00198mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|