ChemNet > CAS > 1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
| produktnavn |
2-(1-Cyclohexenyl)cyclohexanone |
| Engelsk navn |
2-(1-Cyclohexenyl)cyclohexanone;2-(1-cyclohexen-1-yl)-Cyclohexanone |
| Molekylær Formel |
C12H18O |
| Molekylvekt |
178.2707 |
| InChI |
InChI=1/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h6,11H,1-5,7-9H2/t11-/m1/s1 |
| CAS-nummer |
1502-22-3 |
| EINECS |
216-120-3 |
| Molecular Structure |
|
| Tetthet |
1.022g/cm3 |
| Kokepunkt |
281.9°C at 760 mmHg |
| Brytningsindeks |
1.521 |
| Flammepunktet |
116.1°C |
| Damptrykk |
0.00346mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
