ChemNet > CAS > 1527-91-9 N-Phenylbenzamidine
1527-91-9 N-Phenylbenzamidine
| produktnavn |
N-Phenylbenzamidine |
| Engelsk navn |
N-Phenylbenzamidine; N1-Phenylbenzene-1-carboximidamide; N'-phenylbenzenecarboximidamide; N-[(1Z)-amino(phenyl)methylidene]anilinium |
| Molekylær Formel |
C13H13N2 |
| Molekylvekt |
197.2552 |
| InChI |
InChI=1/C13H12N2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15)/p+1 |
| CAS-nummer |
1527-91-9 |
| EINECS |
210-720-9 |
| Molecular Structure |
|
| Smeltepunkt |
118-120℃ |
| Kokepunkt |
346.3°C at 760 mmHg |
| Flammepunktet |
163.3°C |
| Damptrykk |
5.8E-05mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
