ChemNet > CAS > 153912-60-8 (1,5-dimethyl-1H-pyrazol-3-yl)methanol
153912-60-8 (1,5-dimethyl-1H-pyrazol-3-yl)methanol
produktnavn |
(1,5-dimethyl-1H-pyrazol-3-yl)methanol |
Engelsk navn |
(1,5-dimethyl-1H-pyrazol-3-yl)methanol; |
Molekylær Formel |
C6H10N2O |
Molekylvekt |
126.1564 |
InChI |
InChI=1/C6H10N2O/c1-5-3-6(4-9)7-8(5)2/h3,9H,4H2,1-2H3 |
CAS-nummer |
153912-60-8 |
Molecular Structure |
|
Tetthet |
1.13g/cm3 |
Kokepunkt |
248.6°C at 760 mmHg |
Brytningsindeks |
1.543 |
Flammepunktet |
104.1°C |
Damptrykk |
0.0127mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|