ChemNet > CAS > 154-08-5 5-fluoro-dl-tryptophan
154-08-5 5-fluoro-dl-tryptophan
| produktnavn |
5-fluoro-dl-tryptophan |
| Engelsk navn |
5-fluoro-dl-tryptophan; |
| Molekylær Formel |
C11H11FN2O2 |
| Molekylvekt |
222.2156 |
| InChI |
InChI=1/C11H11FN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| CAS-nummer |
154-08-5 |
| EINECS |
205-822-5 |
| Molecular Structure |
|
| Tetthet |
1.442g/cm3 |
| Smeltepunkt |
250℃ |
| Kokepunkt |
450.7°C at 760 mmHg |
| Brytningsindeks |
1.673 |
| Flammepunktet |
226.4°C |
| Damptrykk |
6.54E-09mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
