ChemNet > CAS > 15414-98-9 Trifenylkarbeniumpentaklorostannat
15414-98-9 Trifenylkarbeniumpentaklorostannat
| produktnavn |
Trifenylkarbeniumpentaklorostannat |
| Synonymer |
; Trityl pentaklorostannat; tinn (4 ) trifenylmetyliumklorid (1:1:5) |
| Engelsk navn |
Triphenylcarbenium pentachlorostannate; Trityl pentachlorostannate; tin(4+) triphenylmethylium chloride (1:1:5) |
| Molekylær Formel |
C19H15Cl5Sn |
| Molekylvekt |
539.2974 |
| InChI |
InChI=1/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
| CAS-nummer |
15414-98-9 |
| EINECS |
239-426-9 |
| Molecular Structure |
|
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
