ChemNet > CAS > 1551-44-6 cyclohexyl butyrate
1551-44-6 cyclohexyl butyrate
| produktnavn |
cyclohexyl butyrate |
| Engelsk navn |
cyclohexyl butyrate; Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
| Molekylær Formel |
C10H18O2 |
| Molekylvekt |
170.2487 |
| InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
| CAS-nummer |
1551-44-6 |
| EINECS |
216-290-9 |
| Molecular Structure |
|
| Tetthet |
0.94g/cm3 |
| Kokepunkt |
214.9°C at 760 mmHg |
| Brytningsindeks |
1.449 |
| Flammepunktet |
78°C |
| Damptrykk |
0.152mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
