ChemNet > CAS > 1609-93-4 cis-3-Chloroacrylic acid
1609-93-4 cis-3-Chloroacrylic acid
| produktnavn |
cis-3-Chloroacrylic acid |
| Engelsk navn |
cis-3-Chloroacrylic acid;(Z)-3-Chloroacrylic acid; CCRIS 3547; NSC 202397; cis-beta-Chloroacrylic acid; 2-Propenoic acid, 3-chloro-, (2Z)-; 2-Propenoic acid, 3-chloro-, (Z)- (9CI); Acrylic acid, 3-chloro-, (Z)- (8CI); cis-3-Chloropropenoic acid; (2E)-3-chloroprop-2-enoic acid; (2Z)-3-chloroprop-2-enoic acid; (2Z)-3-chloroprop-2-enoate |
| Molekylær Formel |
C3H2ClO2 |
| Molekylvekt |
105.5003 |
| InChI |
InChI=1/C3H3ClO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/p-1/b2-1- |
| CAS-nummer |
1609-93-4 |
| EINECS |
216-545-4 |
| Molecular Structure |
|
| Smeltepunkt |
60-64℃ |
| Kokepunkt |
192.3°C at 760 mmHg |
| Flammepunktet |
70.1°C |
| Damptrykk |
0.216mmHg at 25°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
