ChemNet > CAS > 162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
produktnavn |
2-Fluoro-4-methoxybenzeneboronic acid |
Engelsk navn |
2-Fluoro-4-methoxybenzeneboronic acid; 2-Fluoro-4-methoxyphenylboronic acid; Fluoro-4-methoxyphenylboronic acid |
Molekylær Formel |
C7H8BFO3 |
Molekylvekt |
169.946 |
InChI |
InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 |
CAS-nummer |
162101-31-7 |
Molecular Structure |
|
Tetthet |
1.265g/cm3 |
Kokepunkt |
291.169°C at 760 mmHg |
Brytningsindeks |
1.504 |
Flammepunktet |
129.895°C |
Damptrykk |
0.001mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|