1635-31-0 3-Aminocoumarin
produktnavn |
3-Aminocoumarin |
Engelsk navn |
3-Aminocoumarin; 3-Coumarinamine; 3-amino-2H-chromen-2-one |
Molekylær Formel |
C9H7NO2 |
Molekylvekt |
161.1574 |
InChI |
InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
CAS-nummer |
1635-31-0 |
EINECS |
216-659-4 |
Molecular Structure |
|
Tetthet |
1.313g/cm3 |
Kokepunkt |
355.2°C at 760 mmHg |
Brytningsindeks |
1.624 |
Flammepunktet |
199.3°C |
Damptrykk |
3.17E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|