ChemNet > CAS > 1674-30-2 2-chloro-1-phenylethanol
1674-30-2 2-chloro-1-phenylethanol
| produktnavn |
2-chloro-1-phenylethanol |
| Engelsk navn |
2-chloro-1-phenylethanol; styrene chlorohydrin; [2-(chloromethyl)phenyl]methanol |
| Molekylær Formel |
C8H9ClO |
| Molekylvekt |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
| CAS-nummer |
1674-30-2 |
| EINECS |
216-816-7 |
| Molecular Structure |
|
| Tetthet |
1.196g/cm3 |
| Kokepunkt |
267.289°C at 760 mmHg |
| Brytningsindeks |
1.562 |
| Flammepunktet |
119.526°C |
| Damptrykk |
0.004mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
