ChemNet > CAS > 16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde
16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde
produktnavn |
3-Bromo-2-hydroxy-5-nitrobenzaldehyde |
Engelsk navn |
3-Bromo-2-hydroxy-5-nitrobenzaldehyde; 3-Bromo-5-nitrosalicylaldehyde |
Molekylær Formel |
C7H4BrNO4 |
Molekylvekt |
246.015 |
InChI |
InChI=1/C7H4BrNO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H |
CAS-nummer |
16789-84-7 |
Molecular Structure |
|
Tetthet |
1.928g/cm3 |
Kokepunkt |
299.6°C at 760 mmHg |
Brytningsindeks |
1.696 |
Flammepunktet |
135°C |
Damptrykk |
0.000662mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|