ChemNet > CAS > 16932-49-3 2,6-Dimethoxybenzonitrile
16932-49-3 2,6-Dimethoxybenzonitrile
produktnavn |
2,6-Dimethoxybenzonitrile |
Engelsk navn |
2,6-Dimethoxybenzonitrile;Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
Molekylær Formel |
C9H9NO2 |
Molekylvekt |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
CAS-nummer |
16932-49-3 |
EINECS |
241-000-2 |
Molecular Structure |
|
Tetthet |
1.12g/cm3 |
Smeltepunkt |
119-123℃ |
Kokepunkt |
306.7°C at 760 mmHg |
Brytningsindeks |
1.519 |
Flammepunktet |
128.8°C |
Damptrykk |
0.000758mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|