ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
produktnavn |
4-Amino-3-ethylbenzonitrile |
Engelsk navn |
4-Amino-3-ethylbenzonitrile; 4-Cyano-2-ethylaniline |
Molekylær Formel |
C9H10N2 |
Molekylvekt |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
CAS-nummer |
170230-87-2 |
Molecular Structure |
|
Tetthet |
1.07g/cm3 |
Kokepunkt |
297.1°C at 760 mmHg |
Brytningsindeks |
1.562 |
Flammepunktet |
133.5°C |
Damptrykk |
0.00138mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|