ChemNet > CAS > 17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
| produktnavn |
ethyl 4-hydroxycyclohexanecarboxylate |
| Engelsk navn |
ethyl 4-hydroxycyclohexanecarboxylate; Ethyl 4-hydroxycyclohexanecarboxylate,mixture of cis and trans; Ethyl 4-hydroxycyclohexane carboxylate |
| Molekylær Formel |
C9H16O3 |
| Molekylvekt |
172.2215 |
| InChI |
InChI=1/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3 |
| CAS-nummer |
17159-80-7 |
| EINECS |
241-215-1 |
| Molecular Structure |
|
| Tetthet |
1.093g/cm3 |
| Kokepunkt |
251.4°C at 760 mmHg |
| Brytningsindeks |
1.481 |
| Flammepunktet |
100.2°C |
| Damptrykk |
0.00322mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
