ChemNet > CAS > 17213-57-9 3,5-Dimethoxybenzoyl chloride
17213-57-9 3,5-Dimethoxybenzoyl chloride
| produktnavn |
3,5-Dimethoxybenzoyl chloride |
| Engelsk navn |
3,5-Dimethoxybenzoyl chloride; |
| Molekylær Formel |
C9H9ClO3 |
| Molekylvekt |
200.619 |
| InChI |
InChI=1/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
| CAS-nummer |
17213-57-9 |
| EINECS |
241-256-5 |
| Molecular Structure |
|
| Tetthet |
1.224g/cm3 |
| Smeltepunkt |
41-47℃ |
| Kokepunkt |
284.5°C at 760 mmHg |
| Brytningsindeks |
1.52 |
| Flammepunktet |
131.1°C |
| Damptrykk |
0.00296mmHg at 25°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
