ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| produktnavn |
2,3-Dichlorothiophene |
| Engelsk navn |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
| Molekylær Formel |
C4H2Cl2S |
| Molekylvekt |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| CAS-nummer |
17249-79-5;17249-29-5 |
| Molecular Structure |
|
| Tetthet |
1.488g/cm3 |
| Smeltepunkt |
-26℃ |
| Kokepunkt |
170.7°C at 760 mmHg |
| Brytningsindeks |
1.584 |
| Flammepunktet |
68.9°C |
| Damptrykk |
1.93mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
