ChemNet > CAS > 17277-58-6 Methyl (phenylthio)acetate
17277-58-6 Methyl (phenylthio)acetate
| produktnavn |
Methyl (phenylthio)acetate |
| Engelsk navn |
Methyl (phenylthio)acetate; Methyl (phenylmercapto)acetate~(Phenylthio)acetic acid methyl ester; methyl (phenylsulfanyl)acetate |
| Molekylær Formel |
C9H10O2S |
| Molekylvekt |
182.2395 |
| InChI |
InChI=1/C9H10O2S/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| CAS-nummer |
17277-58-6 |
| Molecular Structure |
|
| Tetthet |
1.16g/cm3 |
| Kokepunkt |
259.3°C at 760 mmHg |
| Brytningsindeks |
1.556 |
| Flammepunktet |
115.3°C |
| Damptrykk |
0.013mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
