ChemNet > CAS > 175135-96-3 etyl 3-(2-klor-3,4-dimetoksyfenyl)akrylat
175135-96-3 etyl 3-(2-klor-3,4-dimetoksyfenyl)akrylat
produktnavn |
etyl 3-(2-klor-3,4-dimetoksyfenyl)akrylat |
Synonymer |
etyl (2E)-3-(2-klor-3,4-dimetoksyfenyl)prop-2-enoat |
Engelsk navn |
ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate;ethyl (2E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoate |
Molekylær Formel |
C13H15ClO4 |
Molekylvekt |
270.7088 |
InChI |
InChI=1/C13H15ClO4/c1-4-18-11(15)8-6-9-5-7-10(16-2)13(17-3)12(9)14/h5-8H,4H2,1-3H3/b8-6+ |
CAS-nummer |
175135-96-3 |
Molecular Structure |
|
Tetthet |
1.193g/cm3 |
Smeltepunkt |
68℃ |
Kokepunkt |
382.4°C at 760 mmHg |
Brytningsindeks |
1.542 |
Flammepunktet |
151.5°C |
Damptrykk |
4.74E-06mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|