ChemNet > CAS > 175277-95-9 1-ethyl-2-iodo-3-methylbenzene
175277-95-9 1-ethyl-2-iodo-3-methylbenzene
produktnavn |
1-ethyl-2-iodo-3-methylbenzene |
Engelsk navn |
1-ethyl-2-iodo-3-methylbenzene; 2-Ethyl-6-methyliodobenzene |
Molekylær Formel |
C9H11I |
Molekylvekt |
246.0881 |
InChI |
InChI=1/C9H11I/c1-3-8-6-4-5-7(2)9(8)10/h4-6H,3H2,1-2H3 |
CAS-nummer |
175277-95-9 |
Molecular Structure |
|
Tetthet |
1.532g/cm3 |
Kokepunkt |
245°C at 760 mmHg |
Brytningsindeks |
1.581 |
Flammepunktet |
107.1°C |
Damptrykk |
0.0462mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|