1766-76-3 decafluorobenzhydrol
produktnavn |
decafluorobenzhydrol |
Engelsk navn |
decafluorobenzhydrol; Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
Molekylær Formel |
C13H2F10O |
Molekylvekt |
364.1384 |
InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
CAS-nummer |
1766-76-3 |
EINECS |
217-185-0 |
Molecular Structure |
|
Tetthet |
1.74g/cm3 |
Smeltepunkt |
76-80℃ |
Kokepunkt |
265.2°C at 760 mmHg |
Brytningsindeks |
1.457 |
Flammepunktet |
114.2°C |
Damptrykk |
0.00464mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|