ChemNet > CAS > 17687-72-8 9-oktyl-9-heptadekanol
17687-72-8 9-oktyl-9-heptadekanol
| produktnavn |
9-oktyl-9-heptadekanol |
| Synonymer |
; Tri-n-oktylmetanol; 9-oktylheptadekan-9-ol; 6-brom-1H-indol-3-karbaldehyd |
| Engelsk navn |
9-Octyl-9-heptadecanol; Tri-n-octylmethanol; 9-octylheptadecane-9-ol; 6-bromo-1H-indole-3-carbaldehyde |
| Molekylær Formel |
C9H6BrNO |
| Molekylvekt |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-7-1-2-8-6(5-12)4-11-9(8)3-7/h1-5,11H |
| CAS-nummer |
17687-72-8 |
| EINECS |
241-673-2 |
| Molecular Structure |
|
| Tetthet |
1.727g/cm3 |
| Kokepunkt |
395.6°C at 760 mmHg |
| Brytningsindeks |
1.752 |
| Flammepunktet |
193°C |
| Damptrykk |
1.82E-06mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
