ChemNet > CAS > 17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
| produktnavn |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
| Engelsk navn |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
| Molekylær Formel |
C10H7Cl2NS |
| Molekylvekt |
244.1403 |
| InChI |
InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
| CAS-nummer |
17969-22-1 |
| Molecular Structure |
|
| Tetthet |
1.378g/cm3 |
| Smeltepunkt |
78℃ |
| Kokepunkt |
374°C at 760 mmHg |
| Brytningsindeks |
1.617 |
| Flammepunktet |
180°C |
| Damptrykk |
1.85E-05mmHg at 25°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
