ChemNet > CAS > 18066-68-7 Ethyl 3,4-dimethoxyphenylacetate
18066-68-7 Ethyl 3,4-dimethoxyphenylacetate
| produktnavn |
Ethyl 3,4-dimethoxyphenylacetate |
| Engelsk navn |
Ethyl 3,4-dimethoxyphenylacetate; 3,4-Dimethoxyphenylacetic acid ethyl ester |
| Molekylær Formel |
C12H16O4 |
| Molekylvekt |
224.253 |
| InChI |
InChI=1/C12H16O4/c1-4-16-12(13)8-9-5-6-10(14-2)11(7-9)15-3/h5-7H,4,8H2,1-3H3 |
| CAS-nummer |
18066-68-7 |
| EINECS |
241-974-9 |
| Molecular Structure |
|
| Tetthet |
1.084g/cm3 |
| Kokepunkt |
302°C at 760 mmHg |
| Brytningsindeks |
1.494 |
| Flammepunktet |
129.3°C |
| Damptrykk |
0.00102mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
