ChemNet > CAS > 182482-25-3 2,4,6-Trifluorobenzeneboronic acid
182482-25-3 2,4,6-Trifluorobenzeneboronic acid
| produktnavn |
2,4,6-Trifluorobenzeneboronic acid |
| Engelsk navn |
2,4,6-Trifluorobenzeneboronic acid; 2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
| Molekylær Formel |
C6H4BF3O2 |
| Molekylvekt |
175.901 |
| InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
| CAS-nummer |
182482-25-3 |
| Molecular Structure |
|
| Tetthet |
1.44g/cm3 |
| Smeltepunkt |
228-235℃ |
| Kokepunkt |
266°C at 760 mmHg |
| Brytningsindeks |
1.465 |
| Flammepunktet |
114.6°C |
| Damptrykk |
0.00444mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
