ChemNet > CAS > 18355-75-4 2,3-difluorobenzamide
18355-75-4 2,3-difluorobenzamide
| produktnavn |
2,3-difluorobenzamide |
| Engelsk navn |
2,3-difluorobenzamide;2,3-Difluorobenzamide |
| Molekylær Formel |
C7H5F2NO |
| Molekylvekt |
157.1175 |
| InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
| CAS-nummer |
18355-75-4 |
| Molecular Structure |
|
| Tetthet |
1.348g/cm3 |
| Kokepunkt |
197°C at 760 mmHg |
| Brytningsindeks |
1.515 |
| Flammepunktet |
73°C |
| Damptrykk |
0.387mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
