18536-91-9 Dodecyltriethoxysilane
produktnavn |
Dodecyltriethoxysilane |
Engelsk navn |
Dodecyltriethoxysilane; n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
Molekylær Formel |
C16H30O2 |
Molekylvekt |
254.4082 |
InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
CAS-nummer |
18536-91-9 |
EINECS |
242-409-9 |
Molecular Structure |
|
Tetthet |
0.886g/cm3 |
Kokepunkt |
353.1°C at 760 mmHg |
Brytningsindeks |
1.444 |
Flammepunktet |
132.5°C |
Damptrykk |
3.67E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|