ChemNet > CAS > 1875-89-4 3-Methylphenethyl alcohol
1875-89-4 3-Methylphenethyl alcohol
produktnavn |
3-Methylphenethyl alcohol |
Engelsk navn |
3-Methylphenethyl alcohol; 2-m-tolylethanol; 2-(3-Methylphenyl)ethanol; 2-(4-methylphenyl)ethanol; M-METHYL PHENYL ETHANOL; m-Methylphenethyl alcohol |
Molekylær Formel |
C9H12O |
Molekylvekt |
136.191 |
InChI |
InChI=1/C9H12O/c1-8-2-4-9(5-3-8)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS-nummer |
1875-89-4 |
EINECS |
217-508-5 |
Molecular Structure |
|
Tetthet |
1.001g/cm3 |
Kokepunkt |
243.5°C at 760 mmHg |
Brytningsindeks |
1.532 |
Flammepunktet |
107.2°C |
Damptrykk |
0.0172mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|