ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
produktnavn |
Methyl hydrogen isophthalate |
Engelsk navn |
Methyl hydrogen isophthalate; Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate; Isophthalic acid methyl ester |
Molekylær Formel |
C9H8O4 |
Molekylvekt |
180.1574 |
InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
CAS-nummer |
1877-71-0 |
Molecular Structure |
|
Tetthet |
1.288g/cm3 |
Smeltepunkt |
194-196℃ |
Kokepunkt |
339.3°C at 760 mmHg |
Brytningsindeks |
1.556 |
Flammepunktet |
139.6°C |
Damptrykk |
3.6E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|