ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
produktnavn |
Methyl 3-methoxyphenylacetate |
Engelsk navn |
Methyl 3-methoxyphenylacetate; Methyl 2-(3-methoxyphenyl)acetate |
Molekylær Formel |
C10H12O3 |
Molekylvekt |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
CAS-nummer |
18927-05-4 |
Molecular Structure |
|
Tetthet |
1.083g/cm3 |
Kokepunkt |
254°C at 760 mmHg |
Brytningsindeks |
1.499 |
Flammepunktet |
100.2°C |
Damptrykk |
0.0176mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|